C31H35NO12 — CID 45277358
[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylate (PubChem CID 45277358) has the molecular formula C31H35NO12 and a molecular weight of 613.62 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 45277358 |
| Molecular Formula | C31H35NO12 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 5-methyl-2,3-diphenyl-1,2-oxazolidine-4-carboxylate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)C2C(C)ON(c3ccccc3)C2c2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H35NO12/c1-17-25(26(22-12-8-6-9-13-22)32(44-17)23-14-10-7-11-15-23)30(37)43-31-29(41-21(5)36)28(40-20(4)35)27(39-19(3)34)24(42-31)16-38-18(2)33/h6-15,17,24-29,31H,16H2,1-5H3/t17?,24-,25?,26?,27-,28+,29-,31+/m1/s1 |
| InChIKey | VZRVLGDYVFMDBS-RQQJYVLZSA-N |
| XLogP | 2.81 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|