About 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene
1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene (PubChem CID 45277382) has the molecular formula C28H16F4
and a molecular weight of 428.43 g/mol. Its IUPAC name is 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene.
Molecular Properties
| Compound Name | 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene |
| PubChem CID | 45277382 |
| Molecular Formula | C28H16F4 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene |
| SMILES | Fc1ccc(C#CC(=C(c2ccc(F)cc2)c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H16F4/c29-23-10-1-19(2-11-23)3-18-27(20-4-12-24(30)13-5-20)28(21-6-14-25(31)15-7-21)22-8-16-26(32)17-9-22/h1-2,4-17H |
| InChIKey | MHTZBCBVNVHGLK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene?
The IUPAC name of 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene (CID 45277382) is 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene.
What is the SMILES notation for 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene?
The canonical SMILES for 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene is Fc1ccc(C#CC(=C(c2ccc(F)cc2)c2ccc(F)cc2)c2ccc(F)cc2)cc1.
What is the InChIKey of 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene?
The InChIKey is MHTZBCBVNVHGLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H16F4/c29-23-10-1-19(2-11-23)3-18-27(20-4-12-24(30)13-5-20)28(21-6-14-25(31)15-7-21)22-8-16-26(32)17-9-22/h1-2,4-17H.
What are the key properties of 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene?
1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene has a molecular weight of 428.43 g/mol, XLogP of 7.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-[1,2,4-tris(4-fluorophenyl)but-1-en-3-ynyl]benzene is sourced from PubChem (CID 45277382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).