About CID 45277764
CID 45277764 (PubChem CID 45277764) has the molecular formula C22H30NO6SSi
and a molecular weight of 464.64 g/mol.
Molecular Properties
| Compound Name | CID 45277764 |
| PubChem CID | 45277764 |
| Molecular Formula | C22H30NO6SSi |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C22H30NO6SSi/c1-8-13-28-20(26)18(25)23-17(24)16(14(2)29-31(6,7)22(3,4)5)19(23)30-21(27)15-11-9-10-12-15/h8-12,14,16,19H,1,13H2,2-7H3/t14-,16+,19-/m1/s1 |
| InChIKey | BJRVZZFXCUPEKJ-SIXWZSSISA-N |
| XLogP | 3.10 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 45277764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45277764?
The IUPAC name of CID 45277764 (CID 45277764) is not available.
What is the SMILES notation for CID 45277764?
The canonical SMILES for CID 45277764 is C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 45277764?
The InChIKey is BJRVZZFXCUPEKJ-SIXWZSSISA-N. The full InChI is InChI=1S/C22H30NO6SSi/c1-8-13-28-20(26)18(25)23-17(24)16(14(2)29-31(6,7)22(3,4)5)19(23)30-21(27)15-11-9-10-12-15/h8-12,14,16,19H,1,13H2,2-7H3/t14-,16+,19-/m1/s1.
What are the key properties of CID 45277764?
CID 45277764 has a molecular weight of 464.64 g/mol, XLogP of 3.10, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45277764 is sourced from PubChem (CID 45277764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).