About CID 45277915
CID 45277915 (PubChem CID 45277915) has the molecular formula C28H37FeNO6SSi+2
and a molecular weight of 599.60 g/mol.
Molecular Properties
| Compound Name | CID 45277915 |
| PubChem CID | 45277915 |
| Molecular Formula | C28H37FeNO6SSi+2 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C23H32NO6SSi.C5H5.Fe/c1-8-13-29-22(28)20(27)24-19(26)18(15(2)30-32(6,7)23(3,4)5)21(24)31-17(25)14-16-11-9-10-12-16;1-2-4-5-3-1;/h8-12,15,18,21H,1,13-14H2,2-7H3;1-5H;/q;;+2/t15-,18+,21-;;/m1../s1 |
| InChIKey | YLICHJSDLYRDJL-XNWCQREASA-N |
| XLogP | 4.51 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 45277915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45277915?
The IUPAC name of CID 45277915 (CID 45277915) is not available.
What is the SMILES notation for CID 45277915?
The canonical SMILES for CID 45277915 is C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 45277915?
The InChIKey is YLICHJSDLYRDJL-XNWCQREASA-N. The full InChI is InChI=1S/C23H32NO6SSi.C5H5.Fe/c1-8-13-29-22(28)20(27)24-19(26)18(15(2)30-32(6,7)23(3,4)5)21(24)31-17(25)14-16-11-9-10-12-16;1-2-4-5-3-1;/h8-12,15,18,21H,1,13-14H2,2-7H3;1-5H;/q;;+2/t15-,18+,21-;;/m1../s1.
What are the key properties of CID 45277915?
CID 45277915 has a molecular weight of 599.60 g/mol, XLogP of 4.51, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45277915 is sourced from PubChem (CID 45277915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).