About CID 45277920
CID 45277920 (PubChem CID 45277920) has the molecular formula C25H36NO6SSi
and a molecular weight of 506.72 g/mol.
Molecular Properties
| Compound Name | CID 45277920 |
| PubChem CID | 45277920 |
| Molecular Formula | C25H36NO6SSi |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)CCC[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C25H36NO6SSi/c1-8-16-31-24(30)22(29)26-21(28)20(17(2)32-34(6,7)25(3,4)5)23(26)33-19(27)15-11-14-18-12-9-10-13-18/h8-10,12-13,17,20,23H,1,11,14-16H2,2-7H3/t17-,20+,23-/m1/s1 |
| InChIKey | RENUOBYJOFMYBU-DHJUGAMNSA-N |
| XLogP | 4.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 45277920 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45277920?
The IUPAC name of CID 45277920 (CID 45277920) is not available.
What is the SMILES notation for CID 45277920?
The canonical SMILES for CID 45277920 is C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)CCC[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 45277920?
The InChIKey is RENUOBYJOFMYBU-DHJUGAMNSA-N. The full InChI is InChI=1S/C25H36NO6SSi/c1-8-16-31-24(30)22(29)26-21(28)20(17(2)32-34(6,7)25(3,4)5)23(26)33-19(27)15-11-14-18-12-9-10-13-18/h8-10,12-13,17,20,23H,1,11,14-16H2,2-7H3/t17-,20+,23-/m1/s1.
What are the key properties of CID 45277920?
CID 45277920 has a molecular weight of 506.72 g/mol, XLogP of 4.27, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45277920 is sourced from PubChem (CID 45277920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).