C20H17ClN6O2 — CID 45278118
5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-phenyl-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 45278118) has the molecular formula C20H17ClN6O2 and a molecular weight of 408.85 g/mol. Its IUPAC name is 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-phenyl-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-phenyl-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 45278118 |
| Molecular Formula | C20H17ClN6O2 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-phenyl-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | N#CC1=C(N)N2CCN(Cc3ccc(Cl)nc3)C2=C([N+](=O)[O-])C1c1ccccc1 |
| InChI | InChI=1S/C20H17ClN6O2/c21-16-7-6-13(11-24-16)12-25-8-9-26-19(23)15(10-22)17(14-4-2-1-3-5-14)18(20(25)26)27(28)29/h1-7,11,17H,8-9,12,23H2 |
| InChIKey | ZRIMTCNTTDQAOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|