C18H30N6O4 — CID 45278194
7,16-bis(1H-imidazol-2-yl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane (PubChem CID 45278194) has the molecular formula C18H30N6O4 and a molecular weight of 394.48 g/mol. Its IUPAC name is 7,16-bis(1H-imidazol-2-yl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane.
| Compound Name | 7,16-bis(1H-imidazol-2-yl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
|---|---|
| PubChem CID | 45278194 |
| Molecular Formula | C18H30N6O4 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 7,16-bis(1H-imidazol-2-yl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
| SMILES | c1c[nH]c(N2CCOCCOCCN(c3ncc[nH]3)CCOCCOCC2)n1 |
| InChI | InChI=1S/C18H30N6O4/c1-2-20-17(19-1)23-5-9-25-13-15-27-11-7-24(18-21-3-4-22-18)8-12-28-16-14-26-10-6-23/h1-4H,5-16H2,(H,19,20)(H,21,22) |
| InChIKey | MWNMWXBCAYMHIQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |