C23H32NO4SSi — CID 45278229
CID 45278229 (PubChem CID 45278229) has the molecular formula C23H32NO4SSi and a molecular weight of 446.67 g/mol.
| Compound Name | CID 45278229 |
|---|---|
| PubChem CID | 45278229 |
| Molecular Formula | C23H32NO4SSi |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C1=C(C[C]2[CH][CH][CH][CH]2)S[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C23H32NO4SSi/c1-8-13-27-22(26)19-17(14-16-11-9-10-12-16)29-21-18(20(25)24(19)21)15(2)28-30(6,7)23(3,4)5/h8-12,15,18,21H,1,13-14H2,2-7H3/t15-,18+,21-/m1/s1 |
| InChIKey | AAYWVNOJRPPCSZ-FYINFDKHSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|