C28H36N4O — CID 45278721
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45278721) has the molecular formula C28H36N4O and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278721 |
| Molecular Formula | C28H36N4O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3cc(-c4ccccc4)n(C)c3C)CC2)c1C |
| InChI | InChI=1S/C28H36N4O/c1-21-10-8-13-26(22(21)2)32-18-16-31(17-19-32)15-9-14-29-28(33)25-20-27(30(4)23(25)3)24-11-6-5-7-12-24/h5-8,10-13,20H,9,14-19H2,1-4H3,(H,29,33) |
| InChIKey | NUHJBHFWIFYLHK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|