C32H43N5O — CID 45278804
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-1-piperidin-1-ylpyrrole-3-carboxamide (PubChem CID 45278804) has the molecular formula C32H43N5O and a molecular weight of 513.73 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-1-piperidin-1-ylpyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-1-piperidin-1-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278804 |
| Molecular Formula | C32H43N5O |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenyl-1-piperidin-1-ylpyrrole-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3cc(-c4ccccc4)n(N4CCCCC4)c3C)CC2)c1C |
| InChI | InChI=1S/C32H43N5O/c1-25-12-10-15-30(26(25)2)35-22-20-34(21-23-35)17-11-16-33-32(38)29-24-31(28-13-6-4-7-14-28)37(27(29)3)36-18-8-5-9-19-36/h4,6-7,10,12-15,24H,5,8-9,11,16-23H2,1-3H3,(H,33,38) |
| InChIKey | WKVATBBYNLTZNW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|