C26H30Cl2N4O — CID 45278805
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45278805) has the molecular formula C26H30Cl2N4O and a molecular weight of 485.46 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278805 |
| Molecular Formula | C26H30Cl2N4O |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H30Cl2N4O/c1-19-21(18-24(30(19)2)20-8-4-3-5-9-20)26(33)29-12-7-13-31-14-16-32(17-15-31)23-11-6-10-22(27)25(23)28/h3-6,8-11,18H,7,12-17H2,1-2H3,(H,29,33) |
| InChIKey | YIHQDWZWZRGAIH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|