C34H46N4O — CID 45278968
1-(cyclohexylmethyl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45278968) has the molecular formula C34H46N4O and a molecular weight of 526.77 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278968 |
| Molecular Formula | C34H46N4O |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3cc(-c4ccccc4)n(CC4CCCCC4)c3C)CC2)c1C |
| InChI | InChI=1S/C34H46N4O/c1-26-12-10-17-32(27(26)2)37-22-20-36(21-23-37)19-11-18-35-34(39)31-24-33(30-15-8-5-9-16-30)38(28(31)3)25-29-13-6-4-7-14-29/h5,8-10,12,15-17,24,29H,4,6-7,11,13-14,18-23,25H2,1-3H3,(H,35,39) |
| InChIKey | IXUUTRACMVUZJF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|