C31H42N4O — CID 45279134
N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2-methyl-5-phenyl-1-propylpyrrole-3-carboxamide (PubChem CID 45279134) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2-methyl-5-phenyl-1-propylpyrrole-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2-methyl-5-phenyl-1-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45279134 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2-methyl-5-phenyl-1-propylpyrrole-3-carboxamide |
| SMILES | CCCn1c(-c2ccccc2)cc(C(=O)NCCCCN2CCN(c3cccc(C)c3C)CC2)c1C |
| InChI | InChI=1S/C31H42N4O/c1-5-17-35-26(4)28(23-30(35)27-13-7-6-8-14-27)31(36)32-16-9-10-18-33-19-21-34(22-20-33)29-15-11-12-24(2)25(29)3/h6-8,11-15,23H,5,9-10,16-22H2,1-4H3,(H,32,36) |
| InChIKey | UQAWWWMXEVRWIO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|