C29H38N4O — CID 45279212
N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45279212) has the molecular formula C29H38N4O and a molecular weight of 458.65 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45279212 |
| Molecular Formula | C29H38N4O |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,2-dimethyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3cc(-c4ccccc4)n(C)c3C)CC2)c1C |
| InChI | InChI=1S/C29H38N4O/c1-22-11-10-14-27(23(22)2)33-19-17-32(18-20-33)16-9-8-15-30-29(34)26-21-28(31(4)24(26)3)25-12-6-5-7-13-25/h5-7,10-14,21H,8-9,15-20H2,1-4H3,(H,30,34) |
| InChIKey | DUUOOYKRZBNLGD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|