About 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide
4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide (PubChem CID 45279224) has the molecular formula C21H26F2N2O2S
and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide |
| PubChem CID | 45279224 |
| Molecular Formula | C21H26F2N2O2S |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide |
| SMILES | CN(C)CC1CCC(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C21H26F2N2O2S/c1-25(2)14-15-3-8-18(9-4-15)24-28(26,27)19-10-5-16(6-11-19)20-12-7-17(22)13-21(20)23/h5-7,10-13,15,18,24H,3-4,8-9,14H2,1-2H3 |
| InChIKey | QTXIZDUPQOJQHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide?
The IUPAC name of 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide (CID 45279224) is 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide.
What is the SMILES notation for 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide?
The canonical SMILES for 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide is CN(C)CC1CCC(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1.
What is the InChIKey of 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide?
The InChIKey is QTXIZDUPQOJQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N2O2S/c1-25(2)14-15-3-8-18(9-4-15)24-28(26,27)19-10-5-16(6-11-19)20-12-7-17(22)13-21(20)23/h5-7,10-13,15,18,24H,3-4,8-9,14H2,1-2H3.
What are the key properties of 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide?
4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide has a molecular weight of 408.51 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenyl)-N-[4-[(dimethylamino)methyl]cyclohexyl]benzenesulfonamide is sourced from PubChem (CID 45279224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).