C17H16ClN3O2S — CID 45279238
12-(4-chlorophenyl)sulfonyl-10-ethynyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene (PubChem CID 45279238) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 12-(4-chlorophenyl)sulfonyl-10-ethynyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene.
| Compound Name | 12-(4-chlorophenyl)sulfonyl-10-ethynyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene |
|---|---|
| PubChem CID | 45279238 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 12-(4-chlorophenyl)sulfonyl-10-ethynyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-diene |
| SMILES | C#CC1CC2Cc3[nH]ncc3C(C1)N2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-2-11-7-13-9-16-15(10-19-20-16)17(8-11)21(13)24(22,23)14-5-3-12(18)4-6-14/h1,3-6,10-11,13,17H,7-9H2,(H,19,20) |
| InChIKey | IMLZVQJYFBAVIP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|