About N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide
N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide (PubChem CID 45279394) has the molecular formula C22H29NO4S
and a molecular weight of 403.54 g/mol. Its IUPAC name is N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide |
| PubChem CID | 45279394 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide |
| SMILES | CCOc1ccccc1-c1ccc([C@H]2CCOC[C@@H]2NS(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C22H29NO4S/c1-4-27-22-8-6-5-7-20(22)18-11-9-17(10-12-18)19-13-14-26-15-21(19)23-28(24,25)16(2)3/h5-12,16,19,21,23H,4,13-15H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | YUIHVYVHQYDHCY-CTNGQTDRSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide?
The IUPAC name of N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide (CID 45279394) is N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide.
What is the SMILES notation for N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide?
The canonical SMILES for N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide is CCOc1ccccc1-c1ccc([C@H]2CCOC[C@@H]2NS(=O)(=O)C(C)C)cc1.
What is the InChIKey of N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide?
The InChIKey is YUIHVYVHQYDHCY-CTNGQTDRSA-N. The full InChI is InChI=1S/C22H29NO4S/c1-4-27-22-8-6-5-7-20(22)18-11-9-17(10-12-18)19-13-14-26-15-21(19)23-28(24,25)16(2)3/h5-12,16,19,21,23H,4,13-15H2,1-3H3/t19-,21+/m1/s1.
What are the key properties of N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide?
N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide has a molecular weight of 403.54 g/mol, XLogP of 3.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-[4-(2-ethoxyphenyl)phenyl]oxan-3-yl]propane-2-sulfonamide is sourced from PubChem (CID 45279394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).