C21H24FN5O2 — CID 45279408
(9R,10S,11R,13R,14Z)-11-ethyl-6-fluoro-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),14,18,20-heptaene-10-carboxamide (PubChem CID 45279408) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is (9R,10S,11R,13R,14Z)-11-ethyl-6-fluoro-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),14,18,20-heptaene-10-carboxamide.
| Compound Name | (9R,10S,11R,13R,14Z)-11-ethyl-6-fluoro-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),14,18,20-heptaene-10-carboxamide |
|---|---|
| PubChem CID | 45279408 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (9R,10S,11R,13R,14Z)-11-ethyl-6-fluoro-17-oxa-2,4,8,23-tetrazatetracyclo[16.3.1.13,7.09,13]tricosa-1(22),3,5,7(23),14,18,20-heptaene-10-carboxamide |
| SMILES | CC[C@@H]1C[C@@H]2/C=C\COc3cccc(c3)Nc3ncc(F)c(n3)N[C@H]2[C@H]1C(N)=O |
| InChI | InChI=1S/C21H24FN5O2/c1-2-12-9-13-5-4-8-29-15-7-3-6-14(10-15)25-21-24-11-16(22)20(27-21)26-18(13)17(12)19(23)28/h3-7,10-13,17-18H,2,8-9H2,1H3,(H2,23,28)(H2,24,25,26,27)/b5-4-/t12-,13+,17+,18-/m1/s1 |
| InChIKey | ZOYIJIOWRMIXPT-JQGQUBRTSA-N |
| XLogP | 3.24 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|