C19H15F3N4O2S — CID 45279603
16-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-12,13,16-triazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene (PubChem CID 45279603) has the molecular formula C19H15F3N4O2S and a molecular weight of 420.42 g/mol. Its IUPAC name is 16-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-12,13,16-triazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene.
| Compound Name | 16-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-12,13,16-triazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene |
|---|---|
| PubChem CID | 45279603 |
| Molecular Formula | C19H15F3N4O2S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 16-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-12,13,16-triazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,11(15),13-pentaene |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1)N1C2Cc3ccccc3C1c1cn[nH]c1C2 |
| InChI | InChI=1S/C19H15F3N4O2S/c20-19(21,22)17-6-5-13(9-23-17)29(27,28)26-12-7-11-3-1-2-4-14(11)18(26)15-10-24-25-16(15)8-12/h1-6,9-10,12,18H,7-8H2,(H,24,25) |
| InChIKey | UBCKTVNNUAFWBN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |