About 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine
2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45279730) has the molecular formula C17H16F2N4OS
and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 45279730 |
| Molecular Formula | C17H16F2N4OS |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2cc(F)cc(F)c2)nc2sc(CN3CCOCC3)cc12 |
| InChI | InChI=1S/C17H16F2N4OS/c18-11-5-10(6-12(19)7-11)16-21-15(20)14-8-13(25-17(14)22-16)9-23-1-3-24-4-2-23/h5-8H,1-4,9H2,(H2,20,21,22) |
| InChIKey | METFCUFMKYFOQM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (CID 45279730) is 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine is Nc1nc(-c2cc(F)cc(F)c2)nc2sc(CN3CCOCC3)cc12.
What is the InChIKey of 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is METFCUFMKYFOQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N4OS/c18-11-5-10(6-12(19)7-11)16-21-15(20)14-8-13(25-17(14)22-16)9-23-1-3-24-4-2-23/h5-8H,1-4,9H2,(H2,20,21,22).
What are the key properties of 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 362.41 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-6-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 45279730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).