C28H32F3N5O2S — CID 45279792
2-N-[4-[12-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-dien-10-yl]phenyl]cyclohexane-1,2-diamine (PubChem CID 45279792) has the molecular formula C28H32F3N5O2S and a molecular weight of 559.66 g/mol. Its IUPAC name is 2-N-[4-[12-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-dien-10-yl]phenyl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-[4-[12-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-dien-10-yl]phenyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 45279792 |
| Molecular Formula | C28H32F3N5O2S |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 2-N-[4-[12-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,12-triazatricyclo[6.3.1.02,6]dodeca-2(6),3-dien-10-yl]phenyl]cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ccc(C2CC3Cc4[nH]ncc4C(C2)N3S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H32F3N5O2S/c29-28(30,31)19-7-11-22(12-8-19)39(37,38)36-21-13-18(14-27(36)23-16-33-35-26(23)15-21)17-5-9-20(10-6-17)34-25-4-2-1-3-24(25)32/h5-12,16,18,21,24-25,27,34H,1-4,13-15,32H2,(H,33,35) |
| InChIKey | LNNBVNKEPCPJFS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |