About 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole
2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole (PubChem CID 45279832) has the molecular formula C21H19F2N3O
and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole |
| PubChem CID | 45279832 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole |
| SMILES | Cn1ccc2cc(-c3ccc4oc(N5CCC(F)(F)CC5)nc4c3)ccc21 |
| InChI | InChI=1S/C21H19F2N3O/c1-25-9-6-16-12-14(2-4-18(16)25)15-3-5-19-17(13-15)24-20(27-19)26-10-7-21(22,23)8-11-26/h2-6,9,12-13H,7-8,10-11H2,1H3 |
| InChIKey | GXUJUVSHEVJJDA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole (CID 45279832) is 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole is Cn1ccc2cc(-c3ccc4oc(N5CCC(F)(F)CC5)nc4c3)ccc21.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole?
The InChIKey is GXUJUVSHEVJJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N3O/c1-25-9-6-16-12-14(2-4-18(16)25)15-3-5-19-17(13-15)24-20(27-19)26-10-7-21(22,23)8-11-26/h2-6,9,12-13H,7-8,10-11H2,1H3.
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole?
2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole has a molecular weight of 367.40 g/mol, XLogP of 5.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)-5-(1-methylindol-5-yl)-1,3-benzoxazole is sourced from PubChem (CID 45279832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).