About [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate
[4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate (PubChem CID 45279924) has the molecular formula C30H31F7O2S
and a molecular weight of 588.63 g/mol. Its IUPAC name is [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate.
Molecular Properties
| Compound Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
| PubChem CID | 45279924 |
| Molecular Formula | C30H31F7O2S |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(=O)Oc4ccc(S(F)(F)(F)(F)F)cc4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H31F7O2S/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-18-27(31)29(28(32)19-24)30(38)39-25-14-16-26(17-15-25)40(33,34,35,36)37/h10-21H,2-9H2,1H3 |
| InChIKey | VMUZOUYBTLBQSW-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate?
The IUPAC name of [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate (CID 45279924) is [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate.
What is the SMILES notation for [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate?
The canonical SMILES for [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate is CCCCCC1CCC(c2ccc(-c3cc(F)c(C(=O)Oc4ccc(S(F)(F)(F)(F)F)cc4)c(F)c3)cc2)CC1.
What is the InChIKey of [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate?
The InChIKey is VMUZOUYBTLBQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31F7O2S/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-18-27(31)29(28(32)19-24)30(38)39-25-14-16-26(17-15-25)40(33,34,35,36)37/h10-21H,2-9H2,1H3.
What are the key properties of [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate?
[4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate has a molecular weight of 588.63 g/mol, XLogP of 11.36, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate is sourced from PubChem (CID 45279924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).