C24H24N2O4 — CID 45279964
13-(2-aminoanilino)-5-[(2S)-2,3-dihydroxypropoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 45279964) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 13-(2-aminoanilino)-5-[(2S)-2,3-dihydroxypropoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 13-(2-aminoanilino)-5-[(2S)-2,3-dihydroxypropoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 45279964 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 13-(2-aminoanilino)-5-[(2S)-2,3-dihydroxypropoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | Nc1ccccc1Nc1ccc2c(c1)CCc1ccc(OC[C@@H](O)CO)cc1C2=O |
| InChI | InChI=1S/C24H24N2O4/c25-22-3-1-2-4-23(22)26-17-8-10-20-16(11-17)6-5-15-7-9-19(12-21(15)24(20)29)30-14-18(28)13-27/h1-4,7-12,18,26-28H,5-6,13-14,25H2/t18-/m0/s1 |
| InChIKey | VKULQTRXCPMGOH-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|