C24H46O4Si — CID 45280038
(1R,3R,4aR,4bS,6R,8R,8aS,9S,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-3,4b,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthrene-1,6-diol (PubChem CID 45280038) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (1R,3R,4aR,4bS,6R,8R,8aS,9S,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-3,4b,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthrene-1,6-diol.
| Compound Name | (1R,3R,4aR,4bS,6R,8R,8aS,9S,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-3,4b,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthrene-1,6-diol |
|---|---|
| PubChem CID | 45280038 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (1R,3R,4aR,4bS,6R,8R,8aS,9S,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-3,4b,8-trimethyl-1,2,3,4,4a,5,6,7,8a,9,10,10a-dodecahydrophenanthrene-1,6-diol |
| SMILES | C[C@H]1C[C@@H](O)[C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3[C@](C)(CO)C[C@H](O)C[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C24H46O4Si/c1-15-9-18-17(19(27)10-15)11-20(28-29(7,8)22(2,3)4)21-23(5,14-25)12-16(26)13-24(18,21)6/h15-21,25-27H,9-14H2,1-8H3/t15-,16+,17+,18-,19-,20+,21-,23+,24+/m1/s1 |
| InChIKey | DVPJVCBNVYOUHP-DULNGNAOSA-N |
| XLogP | 4.58 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|