C22H17F2NO2 — CID 45280412
13-(2,4-difluoroanilino)-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 45280412) has the molecular formula C22H17F2NO2 and a molecular weight of 365.38 g/mol. Its IUPAC name is 13-(2,4-difluoroanilino)-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 13-(2,4-difluoroanilino)-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 45280412 |
| Molecular Formula | C22H17F2NO2 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 13-(2,4-difluoroanilino)-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | COc1ccc2c(c1)C(=O)c1ccc(Nc3ccc(F)cc3F)cc1CC2 |
| InChI | InChI=1S/C22H17F2NO2/c1-27-17-7-4-13-2-3-14-10-16(6-8-18(14)22(26)19(13)12-17)25-21-9-5-15(23)11-20(21)24/h4-12,25H,2-3H2,1H3 |
| InChIKey | CPDXPKUSKNZCQM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |