C22H19NO2 — CID 45280466
13-anilino-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 45280466) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 13-anilino-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 13-anilino-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 45280466 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 13-anilino-5-methoxytricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | COc1ccc2c(c1)C(=O)c1ccc(Nc3ccccc3)cc1CC2 |
| InChI | InChI=1S/C22H19NO2/c1-25-19-11-9-15-7-8-16-13-18(23-17-5-3-2-4-6-17)10-12-20(16)22(24)21(15)14-19/h2-6,9-14,23H,7-8H2,1H3 |
| InChIKey | ZKKJANWJOBRXAI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |