C23H21ClN2O4S — CID 45280490
2-(4-chlorophenyl)-5-[4-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one (PubChem CID 45280490) has the molecular formula C23H21ClN2O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[4-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one.
| Compound Name | 2-(4-chlorophenyl)-5-[4-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one |
|---|---|
| PubChem CID | 45280490 |
| Molecular Formula | C23H21ClN2O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[4-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-3-methoxyphenyl]-4H-thieno[2,3-c]pyrrol-6-one |
| SMILES | COc1cc(N2Cc3cc(-c4ccc(Cl)cc4)sc3C2=O)ccc1N1C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C23H21ClN2O4S/c1-30-20-9-16(6-7-17(20)25-11-18(27)19(28)12-25)26-10-14-8-21(31-22(14)23(26)29)13-2-4-15(24)5-3-13/h2-9,18-19,27-28H,10-12H2,1H3/t18-,19-/m1/s1 |
| InChIKey | JJSDHJXQUXTTIO-RTBURBONSA-N |
| XLogP | 3.78 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|