C27H25F2NO4 — CID 45280584
6-(2,4-difluoroanilino)-13-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 45280584) has the molecular formula C27H25F2NO4 and a molecular weight of 465.50 g/mol. Its IUPAC name is 6-(2,4-difluoroanilino)-13-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 6-(2,4-difluoroanilino)-13-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 45280584 |
| Molecular Formula | C27H25F2NO4 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 6-(2,4-difluoroanilino)-13-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | CC1(C)OC[C@H](COc2ccc3c(c2)CCc2cc(Nc4ccc(F)cc4F)ccc2C3=O)O1 |
| InChI | InChI=1S/C27H25F2NO4/c1-27(2)33-15-21(34-27)14-32-20-7-9-23-17(12-20)4-3-16-11-19(6-8-22(16)26(23)31)30-25-10-5-18(28)13-24(25)29/h5-13,21,30H,3-4,14-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | BSJHGNQUVPKGIL-NRFANRHFSA-N |
| XLogP | 5.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |