About 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione
8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione (PubChem CID 45280656) has the molecular formula C7H8N4O2
and a molecular weight of 187.21 g/mol. Its IUPAC name is 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione |
| PubChem CID | 45280656 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione |
| SMILES | [2H]c1nc2c([nH]1)c(=O)n(C([2H])([2H])[2H])c(=O)n2C([2H])([2H])[2H] |
| InChI | InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)/i1D3,2D3,3D |
| InChIKey | ZFXYFBGIUFBOJW-YYWVXINBSA-N |
| XLogP | -1.04 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione?
The IUPAC name of 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione (CID 45280656) is 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione.
What is the SMILES notation for 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione?
The canonical SMILES for 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione is [2H]c1nc2c([nH]1)c(=O)n(C([2H])([2H])[2H])c(=O)n2C([2H])([2H])[2H].
What is the InChIKey of 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione?
The InChIKey is ZFXYFBGIUFBOJW-YYWVXINBSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9)/i1D3,2D3,3D.
What are the key properties of 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione?
8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione has a molecular weight of 187.21 g/mol, XLogP of -1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-deuterio-1,3-bis(trideuteriomethyl)-7H-purine-2,6-dione is sourced from PubChem (CID 45280656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).