About dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate
dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate (PubChem CID 45280813) has the molecular formula C13H17N3O7
and a molecular weight of 327.29 g/mol. Its IUPAC name is dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate.
Molecular Properties
| Compound Name | dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate |
| PubChem CID | 45280813 |
| Molecular Formula | C13H17N3O7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](NC(=O)Cn1cc(C)c(=O)[nH]c1=O)C(=O)OC |
| InChI | InChI=1S/C13H17N3O7/c1-7-5-16(13(21)15-11(7)19)6-9(17)14-8(12(20)23-3)4-10(18)22-2/h5,8H,4,6H2,1-3H3,(H,14,17)(H,15,19,21)/t8-/m0/s1 |
| InChIKey | ZTFWALUYXCJUSF-QMMMGPOBSA-N |
| XLogP | -1.93 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The IUPAC name of dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate (CID 45280813) is dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate.
What is the SMILES notation for dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The canonical SMILES for dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate is COC(=O)C[C@H](NC(=O)Cn1cc(C)c(=O)[nH]c1=O)C(=O)OC.
What is the InChIKey of dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The InChIKey is ZTFWALUYXCJUSF-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H17N3O7/c1-7-5-16(13(21)15-11(7)19)6-9(17)14-8(12(20)23-3)4-10(18)22-2/h5,8H,4,6H2,1-3H3,(H,14,17)(H,15,19,21)/t8-/m0/s1.
What are the key properties of dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate has a molecular weight of 327.29 g/mol, XLogP of -1.93, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate is sourced from PubChem (CID 45280813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).