About 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide
2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 45280816) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| PubChem CID | 45280816 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Cc1cn(CC(=O)NCC2CCCO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O4/c1-8-6-15(12(18)14-11(8)17)7-10(16)13-5-9-3-2-4-19-9/h6,9H,2-5,7H2,1H3,(H,13,16)(H,14,17,18) |
| InChIKey | XKXQDAIIUAKPLM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide (CID 45280816) is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The canonical SMILES for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide is Cc1cn(CC(=O)NCC2CCCO2)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The InChIKey is XKXQDAIIUAKPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-8-6-15(12(18)14-11(8)17)7-10(16)13-5-9-3-2-4-19-9/h6,9H,2-5,7H2,1H3,(H,13,16)(H,14,17,18).
What are the key properties of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide has a molecular weight of 267.28 g/mol, XLogP of -0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(oxolan-2-ylmethyl)acetamide is sourced from PubChem (CID 45280816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).