About (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate
(4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate (PubChem CID 45280981) has the molecular formula C27H23NO4
and a molecular weight of 425.48 g/mol. Its IUPAC name is (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate |
| PubChem CID | 45280981 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate |
| SMILES | COc1ccc(OC(=O)N2C/C(=C/c3ccccc3)C(=O)/C(=C\c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-31-24-12-14-25(15-13-24)32-27(30)28-18-22(16-20-8-4-2-5-9-20)26(29)23(19-28)17-21-10-6-3-7-11-21/h2-17H,18-19H2,1H3/b22-16-,23-17- |
| InChIKey | RTUXBVLRCHGASV-IDUDEYGOSA-N |
| XLogP | 5.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate?
The IUPAC name of (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate (CID 45280981) is (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate.
What is the SMILES notation for (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate?
The canonical SMILES for (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate is COc1ccc(OC(=O)N2C/C(=C/c3ccccc3)C(=O)/C(=C\c3ccccc3)C2)cc1.
What is the InChIKey of (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate?
The InChIKey is RTUXBVLRCHGASV-IDUDEYGOSA-N. The full InChI is InChI=1S/C27H23NO4/c1-31-24-12-14-25(15-13-24)32-27(30)28-18-22(16-20-8-4-2-5-9-20)26(29)23(19-28)17-21-10-6-3-7-11-21/h2-17H,18-19H2,1H3/b22-16-,23-17-.
What are the key properties of (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate?
(4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate has a molecular weight of 425.48 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) (3Z,5Z)-3,5-dibenzylidene-4-oxopiperidine-1-carboxylate is sourced from PubChem (CID 45280981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).