About (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione
(6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione (PubChem CID 45281051) has the molecular formula C20H37N3O2
and a molecular weight of 351.54 g/mol. Its IUPAC name is (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione.
Molecular Properties
| Compound Name | (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
| PubChem CID | 45281051 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione |
| SMILES | CC(C)C[C@H]1CNC(=O)C(=O)N1CC1CCN(CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H37N3O2/c1-15(2)12-17-13-21-18(24)19(25)23(17)14-16-6-9-22(10-7-16)11-8-20(3,4)5/h15-17H,6-14H2,1-5H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | ZGAKKXXDDSEZHD-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione?
The IUPAC name of (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione (CID 45281051) is (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione.
What is the SMILES notation for (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione?
The canonical SMILES for (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione is CC(C)C[C@H]1CNC(=O)C(=O)N1CC1CCN(CCC(C)(C)C)CC1.
What is the InChIKey of (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione?
The InChIKey is ZGAKKXXDDSEZHD-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H37N3O2/c1-15(2)12-17-13-21-18(24)19(25)23(17)14-16-6-9-22(10-7-16)11-8-20(3,4)5/h15-17H,6-14H2,1-5H3,(H,21,24)/t17-/m0/s1.
What are the key properties of (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione?
(6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione has a molecular weight of 351.54 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-[[1-(3,3-dimethylbutyl)piperidin-4-yl]methyl]-6-(2-methylpropyl)piperazine-2,3-dione is sourced from PubChem (CID 45281051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).