C21H25N5O — CID 45281067
1-[3-(benzylamino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 45281067) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-[3-(benzylamino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[3-(benzylamino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 45281067 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[3-(benzylamino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ncn(CCCNCc3ccccc3)n2)cc1C |
| InChI | InChI=1S/C21H25N5O/c1-16-9-10-19(13-17(16)2)24-21(27)20-23-15-26(25-20)12-6-11-22-14-18-7-4-3-5-8-18/h3-5,7-10,13,15,22H,6,11-12,14H2,1-2H3,(H,24,27) |
| InChIKey | QASHIQGJWWYCTJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|