C20H30N6O2 — CID 45281068
N-(3,4-dimethylphenyl)-1-[3-(2-morpholin-4-ylethylamino)propyl]-1,2,4-triazole-3-carboxamide (PubChem CID 45281068) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-[3-(2-morpholin-4-ylethylamino)propyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-[3-(2-morpholin-4-ylethylamino)propyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 45281068 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-[3-(2-morpholin-4-ylethylamino)propyl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ncn(CCCNCCN3CCOCC3)n2)cc1C |
| InChI | InChI=1S/C20H30N6O2/c1-16-4-5-18(14-17(16)2)23-20(27)19-22-15-26(24-19)8-3-6-21-7-9-25-10-12-28-13-11-25/h4-5,14-15,21H,3,6-13H2,1-2H3,(H,23,27) |
| InChIKey | KUBMMGOQXPUDRE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|