C23H29N5O — CID 45281080
N-(3,4-dimethylphenyl)-1-[3-(3-phenylpropylamino)propyl]-1,2,4-triazole-3-carboxamide (PubChem CID 45281080) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-[3-(3-phenylpropylamino)propyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-[3-(3-phenylpropylamino)propyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 45281080 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-[3-(3-phenylpropylamino)propyl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ncn(CCCNCCCc3ccccc3)n2)cc1C |
| InChI | InChI=1S/C23H29N5O/c1-18-11-12-21(16-19(18)2)26-23(29)22-25-17-28(27-22)15-7-14-24-13-6-10-20-8-4-3-5-9-20/h3-5,8-9,11-12,16-17,24H,6-7,10,13-15H2,1-2H3,(H,26,29) |
| InChIKey | JOTHTUYCFQVHGI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|