C20H31N5O2 — CID 45281084
N-(3,4-dimethylphenyl)-1-[3-[(1-hydroxy-3-methylpentan-2-yl)amino]propyl]-1,2,4-triazole-3-carboxamide (PubChem CID 45281084) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-[3-[(1-hydroxy-3-methylpentan-2-yl)amino]propyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-[3-[(1-hydroxy-3-methylpentan-2-yl)amino]propyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 45281084 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-[3-[(1-hydroxy-3-methylpentan-2-yl)amino]propyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCC(C)C(CO)NCCCn1cnc(C(=O)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C20H31N5O2/c1-5-14(2)18(12-26)21-9-6-10-25-13-22-19(24-25)20(27)23-17-8-7-15(3)16(4)11-17/h7-8,11,13-14,18,21,26H,5-6,9-10,12H2,1-4H3,(H,23,27) |
| InChIKey | HXESXNDAKNWTFD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|