About 2,4-diethyl-2,6-dimethyl-1H-quinoline
2,4-diethyl-2,6-dimethyl-1H-quinoline (PubChem CID 4528207) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2,4-diethyl-2,6-dimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 2,4-diethyl-2,6-dimethyl-1H-quinoline |
| PubChem CID | 4528207 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2,4-diethyl-2,6-dimethyl-1H-quinoline |
| SMILES | CCC1=CC(C)(CC)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C15H21N/c1-5-12-10-15(4,6-2)16-14-8-7-11(3)9-13(12)14/h7-10,16H,5-6H2,1-4H3 |
| InChIKey | HQFVQELGNGSZQC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-diethyl-2,6-dimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-2,6-dimethyl-1H-quinoline?
The IUPAC name of 2,4-diethyl-2,6-dimethyl-1H-quinoline (CID 4528207) is 2,4-diethyl-2,6-dimethyl-1H-quinoline.
What is the SMILES notation for 2,4-diethyl-2,6-dimethyl-1H-quinoline?
The canonical SMILES for 2,4-diethyl-2,6-dimethyl-1H-quinoline is CCC1=CC(C)(CC)Nc2ccc(C)cc21.
What is the InChIKey of 2,4-diethyl-2,6-dimethyl-1H-quinoline?
The InChIKey is HQFVQELGNGSZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-5-12-10-15(4,6-2)16-14-8-7-11(3)9-13(12)14/h7-10,16H,5-6H2,1-4H3.
What are the key properties of 2,4-diethyl-2,6-dimethyl-1H-quinoline?
2,4-diethyl-2,6-dimethyl-1H-quinoline has a molecular weight of 215.34 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-2,6-dimethyl-1H-quinoline is sourced from PubChem (CID 4528207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).