C12H14N2O4S — CID 45282097
2-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid (PubChem CID 45282097) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid.
| Compound Name | 2-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 45282097 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[1-(methylcarbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid |
| SMILES | CNC(=O)NC(=O)C(C)Sc1ccccc1C(=O)O |
| InChI | InChI=1S/C12H14N2O4S/c1-7(10(15)14-12(18)13-2)19-9-6-4-3-5-8(9)11(16)17/h3-7H,1-2H3,(H,16,17)(H2,13,14,15,18) |
| InChIKey | GKZSJPPVTMGYDT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |