C9H17F4NO — CID 45283084
3,3-dimethyl-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine (PubChem CID 45283084) has the molecular formula C9H17F4NO and a molecular weight of 231.23 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine.
| Compound Name | 3,3-dimethyl-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine |
|---|---|
| PubChem CID | 45283084 |
| Molecular Formula | C9H17F4NO |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3,3-dimethyl-1-(2,2,3,3-tetrafluoropropoxy)butan-2-amine |
| SMILES | CC(C)(C)C(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H17F4NO/c1-8(2,3)6(14)4-15-5-9(12,13)7(10)11/h6-7H,4-5,14H2,1-3H3 |
| InChIKey | YKRYQKKZYVGRHA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|