C22H28FN3O7S — CID 45283692
N-(4-fluorophenyl)-N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylbenzenesulfonamide;oxalic acid (PubChem CID 45283692) has the molecular formula C22H28FN3O7S and a molecular weight of 497.55 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylbenzenesulfonamide;oxalic acid.
| Compound Name | N-(4-fluorophenyl)-N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylbenzenesulfonamide;oxalic acid |
|---|---|
| PubChem CID | 45283692 |
| Molecular Formula | C22H28FN3O7S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-(4-fluorophenyl)-N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylbenzenesulfonamide;oxalic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(O)CN2CCNCC2)c2ccc(F)cc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26FN3O3S.C2H2O4/c1-16-2-8-20(9-3-16)28(26,27)24(18-6-4-17(21)5-7-18)15-19(25)14-23-12-10-22-11-13-23;3-1(4)2(5)6/h2-9,19,22,25H,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LNRWKLLGRIQAJC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|