C16H22N6O3 — CID 4528431
4-N-(2-methoxyphenyl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 4528431) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-methoxyphenyl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 4528431 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1nc(NCCC(C)C)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N6O3/c1-10(2)8-9-18-16-20-14(17)13(22(23)24)15(21-16)19-11-6-4-5-7-12(11)25-3/h4-7,10H,8-9H2,1-3H3,(H4,17,18,19,20,21) |
| InChIKey | WFTNYVFLIWOVLE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|