About ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate
ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate (PubChem CID 4528578) has the molecular formula C25H27N5O5
and a molecular weight of 477.52 g/mol. Its IUPAC name is ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate |
| PubChem CID | 4528578 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(-c3ccc([N+](=O)[O-])cc3)nn2-c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C25H27N5O5/c1-4-35-25(32)28-13-11-27(12-14-28)24(31)23-16-21(19-6-8-20(9-7-19)30(33)34)26-29(23)22-10-5-17(2)15-18(22)3/h5-10,15-16H,4,11-14H2,1-3H3 |
| InChIKey | FBCQBXJFPCMQHU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate (CID 4528578) is ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)c2cc(-c3ccc([N+](=O)[O-])cc3)nn2-c2ccc(C)cc2C)CC1.
What is the InChIKey of ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate?
The InChIKey is FBCQBXJFPCMQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N5O5/c1-4-35-25(32)28-13-11-27(12-14-28)24(31)23-16-21(19-6-8-20(9-7-19)30(33)34)26-29(23)22-10-5-17(2)15-18(22)3/h5-10,15-16H,4,11-14H2,1-3H3.
What are the key properties of ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate?
ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate has a molecular weight of 477.52 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-(2,4-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carbonyl]piperazine-1-carboxylate is sourced from PubChem (CID 4528578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).