C12H11N3O — CID 45286043
2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3,4-dicarbonitrile (PubChem CID 45286043) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3,4-dicarbonitrile.
| Compound Name | 2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 45286043 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3,4-dicarbonitrile |
| SMILES | N#Cc1c2c([nH]c(=O)c1C#N)CCCCC2 |
| InChI | InChI=1S/C12H11N3O/c13-6-9-8-4-2-1-3-5-11(8)15-12(16)10(9)7-14/h1-5H2,(H,15,16) |
| InChIKey | HWDDVAKFKCQCCS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |