C21H15ClN2O5 — CID 4530058
6-amino-8-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile (PubChem CID 4530058) has the molecular formula C21H15ClN2O5 and a molecular weight of 410.81 g/mol. Its IUPAC name is 6-amino-8-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile.
| Compound Name | 6-amino-8-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
|---|---|
| PubChem CID | 4530058 |
| Molecular Formula | C21H15ClN2O5 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 6-amino-8-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
| SMILES | C#CCOc1c(Cl)cc(C2C(C#N)=C(N)Oc3cc4c(cc32)OCO4)cc1OC |
| InChI | InChI=1S/C21H15ClN2O5/c1-3-4-26-20-14(22)5-11(6-18(20)25-2)19-12-7-16-17(28-10-27-16)8-15(12)29-21(24)13(19)9-23/h1,5-8,19H,4,10,24H2,2H3 |
| InChIKey | TUAGWFBGIWOLKG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|