About 3,4-diaminobenzohydrazide
3,4-diaminobenzohydrazide (PubChem CID 4530104) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,4-diaminobenzohydrazide.
Molecular Properties
| Compound Name | 3,4-diaminobenzohydrazide |
| PubChem CID | 4530104 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3,4-diaminobenzohydrazide |
| SMILES | NNC(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12) |
| InChIKey | YGCXQTYRSKMILM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminobenzohydrazide?
The IUPAC name of 3,4-diaminobenzohydrazide (CID 4530104) is 3,4-diaminobenzohydrazide.
What is the SMILES notation for 3,4-diaminobenzohydrazide?
The canonical SMILES for 3,4-diaminobenzohydrazide is NNC(=O)c1ccc(N)c(N)c1.
What is the InChIKey of 3,4-diaminobenzohydrazide?
The InChIKey is YGCXQTYRSKMILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12).
What are the key properties of 3,4-diaminobenzohydrazide?
3,4-diaminobenzohydrazide has a molecular weight of 166.18 g/mol, XLogP of -0.55, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminobenzohydrazide is sourced from PubChem (CID 4530104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).