About 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide
2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide (PubChem CID 4530825) has the molecular formula C20H28N4O2S
and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide |
| PubChem CID | 4530825 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide |
| SMILES | Cc1cc(C)nc(SCC(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C20H28N4O2S/c1-12-3-13(2)22-19(21-12)27-11-18(26)24-23-17(25)10-20-7-14-4-15(8-20)6-16(5-14)9-20/h3,14-16H,4-11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZKLLTQPPJAGWCP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide?
The IUPAC name of 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide (CID 4530825) is 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide.
What is the SMILES notation for 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide?
The canonical SMILES for 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide is Cc1cc(C)nc(SCC(=O)NNC(=O)CC23CC4CC(CC(C4)C2)C3)n1.
What is the InChIKey of 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide?
The InChIKey is ZKLLTQPPJAGWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2S/c1-12-3-13(2)22-19(21-12)27-11-18(26)24-23-17(25)10-20-7-14-4-15(8-20)6-16(5-14)9-20/h3,14-16H,4-11H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide?
2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide has a molecular weight of 388.54 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]acetohydrazide is sourced from PubChem (CID 4530825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).