C20H18BrCl2N3O2S — CID 4531442
10-(4-bromophenyl)-4,6-dichloro-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 4531442) has the molecular formula C20H18BrCl2N3O2S and a molecular weight of 515.26 g/mol. Its IUPAC name is 10-(4-bromophenyl)-4,6-dichloro-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 10-(4-bromophenyl)-4,6-dichloro-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 4531442 |
| Molecular Formula | C20H18BrCl2N3O2S |
| Molecular Weight | 515.26 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | 10-(4-bromophenyl)-4,6-dichloro-N,N,9-trimethyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | CN(C)C(=O)C1C2NC(=S)N(c3ccc(Br)cc3)C1(C)Oc1c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C20H18BrCl2N3O2S/c1-20-15(18(27)25(2)3)16(13-8-11(22)9-14(23)17(13)28-20)24-19(29)26(20)12-6-4-10(21)5-7-12/h4-9,15-16H,1-3H3,(H,24,29) |
| InChIKey | YEYTYGCYFYNSIB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|