About 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid
2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid (PubChem CID 45318659) has the molecular formula C22H17NO5S
and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid |
| PubChem CID | 45318659 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid |
| SMILES | Cc1ccc(Sc2ccc(C(=O)c3ccccc3C(=O)O)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H17NO5S/c1-13-7-9-19(14(2)11-13)29-20-10-8-15(12-18(20)23(27)28)21(24)16-5-3-4-6-17(16)22(25)26/h3-12H,1-2H3,(H,25,26) |
| InChIKey | VJOICZQUGWAWAE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid?
The IUPAC name of 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid (CID 45318659) is 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid.
What is the SMILES notation for 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid?
The canonical SMILES for 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid is Cc1ccc(Sc2ccc(C(=O)c3ccccc3C(=O)O)cc2[N+](=O)[O-])c(C)c1.
What is the InChIKey of 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid?
The InChIKey is VJOICZQUGWAWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO5S/c1-13-7-9-19(14(2)11-13)29-20-10-8-15(12-18(20)23(27)28)21(24)16-5-3-4-6-17(16)22(25)26/h3-12H,1-2H3,(H,25,26).
What are the key properties of 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid?
2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid has a molecular weight of 407.45 g/mol, XLogP of 5.29, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,4-dimethylphenyl)sulfanyl-3-nitrobenzoyl]benzoic acid is sourced from PubChem (CID 45318659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).